C19H21FN2O6 — CID 171686627
3-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carbonyl]-6-fluoro-1H-quinolin-4-one;formic acid (PubChem CID 171686627) has the molecular formula C19H21FN2O6 and a molecular weight of 392.38 g/mol. Its IUPAC name is 3-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carbonyl]-6-fluoro-1H-quinolin-4-one;formic acid.
| Compound Name | 3-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carbonyl]-6-fluoro-1H-quinolin-4-one;formic acid |
|---|---|
| PubChem CID | 171686627 |
| Molecular Formula | C19H21FN2O6 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carbonyl]-6-fluoro-1H-quinolin-4-one;formic acid |
| SMILES | O=C(c1c[nH]c2ccc(F)cc2c1=O)N1C[C@@H]2CCOC[C@]2(CO)C1.O=CO |
| InChI | InChI=1S/C18H19FN2O4.CH2O2/c19-12-1-2-15-13(5-12)16(23)14(6-20-15)17(24)21-7-11-3-4-25-10-18(11,8-21)9-22;2-1-3/h1-2,5-6,11,22H,3-4,7-10H2,(H,20,23);1H,(H,2,3)/t11-,18+;/m0./s1 |
| InChIKey | QSVGEHLZQLHNEG-CXEIHUQYSA-N |
| XLogP | 0.84 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|