C21H27FN2O7 — CID 155972519
6-fluoro-3-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]-1H-quinolin-4-one;formic acid (PubChem CID 155972519) has the molecular formula C21H27FN2O7 and a molecular weight of 438.45 g/mol. Its IUPAC name is 6-fluoro-3-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]-1H-quinolin-4-one;formic acid.
| Compound Name | 6-fluoro-3-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]-1H-quinolin-4-one;formic acid |
|---|---|
| PubChem CID | 155972519 |
| Molecular Formula | C21H27FN2O7 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 6-fluoro-3-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]-1H-quinolin-4-one;formic acid |
| SMILES | COCCC[C@@]1(CO)CN(C(=O)c2c[nH]c3ccc(F)cc3c2=O)CC[C@H]1O.O=CO |
| InChI | InChI=1S/C20H25FN2O5.CH2O2/c1-28-8-2-6-20(12-24)11-23(7-5-17(20)25)19(27)15-10-22-16-4-3-13(21)9-14(16)18(15)26;2-1-3/h3-4,9-10,17,24-25H,2,5-8,11-12H2,1H3,(H,22,26);1H,(H,2,3)/t17-,20+;/m1./s1 |
| InChIKey | ZZOMRHZLPKXWSB-XLCHORMMSA-N |
| XLogP | 0.98 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|