C15H16FN3O2 — CID 113205617
1-[4-(5-fluoro-1H-indole-3-carbonyl)piperazin-1-yl]ethanone (PubChem CID 113205617) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 1-[4-(5-fluoro-1H-indole-3-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(5-fluoro-1H-indole-3-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 113205617 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-[4-(5-fluoro-1H-indole-3-carbonyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2c[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C15H16FN3O2/c1-10(20)18-4-6-19(7-5-18)15(21)13-9-17-14-3-2-11(16)8-12(13)14/h2-3,8-9,17H,4-7H2,1H3 |
| InChIKey | RESOKRFFTWDIAG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |