C20H22FN5O — CID 57234124
[4-[3-(ethylamino)-2-pyridinyl]piperazin-1-yl]-(5-fluoro-1H-indol-3-yl)methanone (PubChem CID 57234124) has the molecular formula C20H22FN5O and a molecular weight of 367.43 g/mol. Its IUPAC name is [4-[3-(ethylamino)-2-pyridinyl]piperazin-1-yl]-(5-fluoro-1H-indol-3-yl)methanone.
| Compound Name | [4-[3-(ethylamino)-2-pyridinyl]piperazin-1-yl]-(5-fluoro-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 57234124 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [4-[3-(ethylamino)-2-pyridinyl]piperazin-1-yl]-(5-fluoro-1H-indol-3-yl)methanone |
| SMILES | CCNc1cccnc1N1CCN(C(=O)c2c[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C20H22FN5O/c1-2-22-18-4-3-7-23-19(18)25-8-10-26(11-9-25)20(27)16-13-24-17-6-5-14(21)12-15(16)17/h3-7,12-13,22,24H,2,8-11H2,1H3 |
| InChIKey | YPLCFNYVBJEAQT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |