C27H29N5O2 — CID 57065668
[4-[3-(ethylamino)-2-pyridinyl]piperazin-1-yl]-(5-phenylmethoxy-1H-indol-3-yl)methanone (PubChem CID 57065668) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is [4-[3-(ethylamino)-2-pyridinyl]piperazin-1-yl]-(5-phenylmethoxy-1H-indol-3-yl)methanone.
| Compound Name | [4-[3-(ethylamino)-2-pyridinyl]piperazin-1-yl]-(5-phenylmethoxy-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 57065668 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | [4-[3-(ethylamino)-2-pyridinyl]piperazin-1-yl]-(5-phenylmethoxy-1H-indol-3-yl)methanone |
| SMILES | CCNc1cccnc1N1CCN(C(=O)c2c[nH]c3ccc(OCc4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C27H29N5O2/c1-2-28-25-9-6-12-29-26(25)31-13-15-32(16-14-31)27(33)23-18-30-24-11-10-21(17-22(23)24)34-19-20-7-4-3-5-8-20/h3-12,17-18,28,30H,2,13-16,19H2,1H3 |
| InChIKey | CMFSWVRUAFUONP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |