C23H29N5O4S — CID 57028318
[3-[4-[3-(propan-2-ylamino)-2-pyridinyl]piperazine-1-carbonyl]-1H-indol-6-yl]methyl methanesulfonate (PubChem CID 57028318) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is [3-[4-[3-(propan-2-ylamino)-2-pyridinyl]piperazine-1-carbonyl]-1H-indol-6-yl]methyl methanesulfonate.
| Compound Name | [3-[4-[3-(propan-2-ylamino)-2-pyridinyl]piperazine-1-carbonyl]-1H-indol-6-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 57028318 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | [3-[4-[3-(propan-2-ylamino)-2-pyridinyl]piperazine-1-carbonyl]-1H-indol-6-yl]methyl methanesulfonate |
| SMILES | CC(C)Nc1cccnc1N1CCN(C(=O)c2c[nH]c3cc(COS(C)(=O)=O)ccc23)CC1 |
| InChI | InChI=1S/C23H29N5O4S/c1-16(2)26-20-5-4-8-24-22(20)27-9-11-28(12-10-27)23(29)19-14-25-21-13-17(6-7-18(19)21)15-32-33(3,30)31/h4-8,13-14,16,25-26H,9-12,15H2,1-3H3 |
| InChIKey | QTXKSRIMZGMPSI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|