C25H27N5O — CID 57258489
3H-benzo[e]indol-1-yl-[4-[3-(propan-2-ylamino)-2-pyridinyl]piperazin-1-yl]methanone (PubChem CID 57258489) has the molecular formula C25H27N5O and a molecular weight of 413.53 g/mol. Its IUPAC name is 3H-benzo[e]indol-1-yl-[4-[3-(propan-2-ylamino)-2-pyridinyl]piperazin-1-yl]methanone.
| Compound Name | 3H-benzo[e]indol-1-yl-[4-[3-(propan-2-ylamino)-2-pyridinyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 57258489 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 3H-benzo[e]indol-1-yl-[4-[3-(propan-2-ylamino)-2-pyridinyl]piperazin-1-yl]methanone |
| SMILES | CC(C)Nc1cccnc1N1CCN(C(=O)c2c[nH]c3ccc4ccccc4c23)CC1 |
| InChI | InChI=1S/C25H27N5O/c1-17(2)28-22-8-5-11-26-24(22)29-12-14-30(15-13-29)25(31)20-16-27-21-10-9-18-6-3-4-7-19(18)23(20)21/h3-11,16-17,27-28H,12-15H2,1-2H3 |
| InChIKey | CZVZKKNAHJLNLE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |