C24H29N3O5 — CID 172660542
methyl 3-[[(3aS,5R,6R,7aR)-2-[6-(dimethylcarbamoyl)-2-pyridinyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate (PubChem CID 172660542) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is methyl 3-[[(3aS,5R,6R,7aR)-2-[6-(dimethylcarbamoyl)-2-pyridinyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate.
| Compound Name | methyl 3-[[(3aS,5R,6R,7aR)-2-[6-(dimethylcarbamoyl)-2-pyridinyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate |
|---|---|
| PubChem CID | 172660542 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | methyl 3-[[(3aS,5R,6R,7aR)-2-[6-(dimethylcarbamoyl)-2-pyridinyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate |
| SMILES | COC(=O)c1cccc(O[C@@H]2C[C@@H]3CN(c4cccc(C(=O)N(C)C)n4)C[C@@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C24H29N3O5/c1-26(2)23(29)19-8-5-9-22(25-19)27-13-16-11-20(28)21(12-17(16)14-27)32-18-7-4-6-15(10-18)24(30)31-3/h4-10,16-17,20-21,28H,11-14H2,1-3H3/t16-,17+,20+,21+/m0/s1 |
| InChIKey | PKQFMUNFFFWBAI-XWDORNJCSA-N |
| XLogP | 2.22 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |