C24H29N5O2 — CID 172660857
(1R,9S)-5-(morpholin-4-ylmethyl)-11-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 172660857) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is (1R,9S)-5-(morpholin-4-ylmethyl)-11-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-5-(morpholin-4-ylmethyl)-11-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 172660857 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | (1R,9S)-5-(morpholin-4-ylmethyl)-11-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1c(CN2CCOCC2)ccc2n1C[C@H]1C[C@@H]2CN(Cc2c[nH]c3cnccc23)C1 |
| InChI | InChI=1S/C24H29N5O2/c30-24-18(14-27-5-7-31-8-6-27)1-2-23-19-9-17(13-29(23)24)12-28(15-19)16-20-10-26-22-11-25-4-3-21(20)22/h1-4,10-11,17,19,26H,5-9,12-16H2/t17-,19+/m0/s1 |
| InChIKey | AHEYMPYYVVVBMX-PKOBYXMFSA-N |
| XLogP | 2.18 |
| TPSA | 66.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |