C23H28N4O2 — CID 175641340
(1R,9S)-5-[[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methyl]-11-(pyridin-4-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 175641340) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is (1R,9S)-5-[[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methyl]-11-(pyridin-4-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-5-[[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methyl]-11-(pyridin-4-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 175641340 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (1R,9S)-5-[[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methyl]-11-(pyridin-4-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1c(CN2C[C@H]3C[C@@H]2CO3)ccc2n1C[C@H]1C[C@@H]2CN(Cc2ccncc2)C1 |
| InChI | InChI=1S/C23H28N4O2/c28-23-18(13-26-14-21-8-20(26)15-29-21)1-2-22-19-7-17(11-27(22)23)10-25(12-19)9-16-3-5-24-6-4-16/h1-6,17,19-21H,7-15H2/t17-,19+,20+,21+/m0/s1 |
| InChIKey | IHXXBEPDMPUCED-OYNPSCLESA-N |
| XLogP | 1.84 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |