C25H28N4O2 — CID 176500920
3-[[(1R,9S)-5-[[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]benzonitrile (PubChem CID 176500920) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 3-[[(1R,9S)-5-[[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]benzonitrile.
| Compound Name | 3-[[(1R,9S)-5-[[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 176500920 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 3-[[(1R,9S)-5-[[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2C[C@@H]3C[C@H](C2)c2ccc(CN4C[C@H]5C[C@@H]4CO5)c(=O)n2C3)c1 |
| InChI | InChI=1S/C25H28N4O2/c26-9-17-2-1-3-18(6-17)10-27-11-19-7-21(13-27)24-5-4-20(25(30)29(24)12-19)14-28-15-23-8-22(28)16-31-23/h1-6,19,21-23H,7-8,10-16H2/t19-,21+,22+,23+/m0/s1 |
| InChIKey | OVWHQEOVDAUSIJ-MLDBQTBOSA-N |
| XLogP | 2.31 |
| TPSA | 61.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |