C24H25N3O5 — CID 172662261
1-(1,3-benzodioxol-5-ylmethyl)-4-methyl-N-[3-(2-methyl-6-oxo-1-pyridinyl)propyl]-2-oxopyridine-3-carboxamide (PubChem CID 172662261) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-methyl-N-[3-(2-methyl-6-oxo-1-pyridinyl)propyl]-2-oxopyridine-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-methyl-N-[3-(2-methyl-6-oxo-1-pyridinyl)propyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 172662261 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-methyl-N-[3-(2-methyl-6-oxo-1-pyridinyl)propyl]-2-oxopyridine-3-carboxamide |
| SMILES | Cc1ccn(Cc2ccc3c(c2)OCO3)c(=O)c1C(=O)NCCCn1c(C)cccc1=O |
| InChI | InChI=1S/C24H25N3O5/c1-16-9-12-26(14-18-7-8-19-20(13-18)32-15-31-19)24(30)22(16)23(29)25-10-4-11-27-17(2)5-3-6-21(27)28/h3,5-9,12-13H,4,10-11,14-15H2,1-2H3,(H,25,29) |
| InChIKey | SKZOHKUNSLOWST-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|