C23H22N2O4 — CID 53124283
N-(1,3-benzodioxol-5-ylmethyl)-2-[1-[(3,4-dimethylphenyl)methyl]pyrrol-2-yl]-2-oxoacetamide (PubChem CID 53124283) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[1-[(3,4-dimethylphenyl)methyl]pyrrol-2-yl]-2-oxoacetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[1-[(3,4-dimethylphenyl)methyl]pyrrol-2-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 53124283 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[1-[(3,4-dimethylphenyl)methyl]pyrrol-2-yl]-2-oxoacetamide |
| SMILES | Cc1ccc(Cn2cccc2C(=O)C(=O)NCc2ccc3c(c2)OCO3)cc1C |
| InChI | InChI=1S/C23H22N2O4/c1-15-5-6-18(10-16(15)2)13-25-9-3-4-19(25)22(26)23(27)24-12-17-7-8-20-21(11-17)29-14-28-20/h3-11H,12-14H2,1-2H3,(H,24,27) |
| InChIKey | UGURCFSAOPSTEP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|