C20H18ClN3O2 — CID 53124248
N-(5-chloro-2-pyridinyl)-2-[1-[(3,4-dimethylphenyl)methyl]pyrrol-2-yl]-2-oxoacetamide (PubChem CID 53124248) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[1-[(3,4-dimethylphenyl)methyl]pyrrol-2-yl]-2-oxoacetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[1-[(3,4-dimethylphenyl)methyl]pyrrol-2-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 53124248 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[1-[(3,4-dimethylphenyl)methyl]pyrrol-2-yl]-2-oxoacetamide |
| SMILES | Cc1ccc(Cn2cccc2C(=O)C(=O)Nc2ccc(Cl)cn2)cc1C |
| InChI | InChI=1S/C20H18ClN3O2/c1-13-5-6-15(10-14(13)2)12-24-9-3-4-17(24)19(25)20(26)23-18-8-7-16(21)11-22-18/h3-11H,12H2,1-2H3,(H,22,23,26) |
| InChIKey | OJEXBIJLYOULDB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|