C21H19FN2O2 — CID 53124203
N-(2,5-dimethylphenyl)-2-[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]-2-oxoacetamide (PubChem CID 53124203) has the molecular formula C21H19FN2O2 and a molecular weight of 350.39 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]-2-oxoacetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 53124203 |
| Molecular Formula | C21H19FN2O2 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]-2-oxoacetamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(=O)c2cccn2Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H19FN2O2/c1-14-5-6-15(2)18(12-14)23-21(26)20(25)19-4-3-11-24(19)13-16-7-9-17(22)10-8-16/h3-12H,13H2,1-2H3,(H,23,26) |
| InChIKey | BHFBETLRJPIOJJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|