C22H22N2O2S — CID 53124303
2-[1-[(3,4-dimethylphenyl)methyl]pyrrol-2-yl]-N-(3-methylsulfanylphenyl)-2-oxoacetamide (PubChem CID 53124303) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-[1-[(3,4-dimethylphenyl)methyl]pyrrol-2-yl]-N-(3-methylsulfanylphenyl)-2-oxoacetamide.
| Compound Name | 2-[1-[(3,4-dimethylphenyl)methyl]pyrrol-2-yl]-N-(3-methylsulfanylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 53124303 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-[1-[(3,4-dimethylphenyl)methyl]pyrrol-2-yl]-N-(3-methylsulfanylphenyl)-2-oxoacetamide |
| SMILES | CSc1cccc(NC(=O)C(=O)c2cccn2Cc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C22H22N2O2S/c1-15-9-10-17(12-16(15)2)14-24-11-5-8-20(24)21(25)22(26)23-18-6-4-7-19(13-18)27-3/h4-13H,14H2,1-3H3,(H,23,26) |
| InChIKey | PWIUXQUWRCOLBC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|