C21H27N7O2 — CID 172662433
(1R,9S)-5-[1-[2-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]imidazol-2-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 172662433) has the molecular formula C21H27N7O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is (1R,9S)-5-[1-[2-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]imidazol-2-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-5-[1-[2-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]imidazol-2-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 172662433 |
| Molecular Formula | C21H27N7O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | (1R,9S)-5-[1-[2-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]imidazol-2-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | COCCn1cnnc1CCn1ccnc1-c1ccc2n(c1=O)C[C@@H]1CNC[C@H]2C1 |
| InChI | InChI=1S/C21H27N7O2/c1-30-9-8-27-14-24-25-19(27)4-6-26-7-5-23-20(26)17-2-3-18-16-10-15(11-22-12-16)13-28(18)21(17)29/h2-3,5,7,14-16,22H,4,6,8-13H2,1H3/t15-,16+/m0/s1 |
| InChIKey | JLDJALWJVAEQBH-JKSUJKDBSA-N |
| XLogP | 0.90 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |