C25H27N3O3 — CID 172665946
4-methyl-1-(3-propan-2-ylphenyl)-3-(2-pyridin-3-ylmorpholine-4-carbonyl)pyridin-2-one (PubChem CID 172665946) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-methyl-1-(3-propan-2-ylphenyl)-3-(2-pyridin-3-ylmorpholine-4-carbonyl)pyridin-2-one.
| Compound Name | 4-methyl-1-(3-propan-2-ylphenyl)-3-(2-pyridin-3-ylmorpholine-4-carbonyl)pyridin-2-one |
|---|---|
| PubChem CID | 172665946 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 4-methyl-1-(3-propan-2-ylphenyl)-3-(2-pyridin-3-ylmorpholine-4-carbonyl)pyridin-2-one |
| SMILES | Cc1ccn(-c2cccc(C(C)C)c2)c(=O)c1C(=O)N1CCOC(c2cccnc2)C1 |
| InChI | InChI=1S/C25H27N3O3/c1-17(2)19-6-4-8-21(14-19)28-11-9-18(3)23(25(28)30)24(29)27-12-13-31-22(16-27)20-7-5-10-26-15-20/h4-11,14-15,17,22H,12-13,16H2,1-3H3 |
| InChIKey | YPXOREJYTQCXHL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |