C20H20N2O2 — CID 172666857
N,N-dimethyl-2-(4-pyridin-4-ylnaphthalen-2-yl)oxypropanamide (PubChem CID 172666857) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-pyridin-4-ylnaphthalen-2-yl)oxypropanamide.
| Compound Name | N,N-dimethyl-2-(4-pyridin-4-ylnaphthalen-2-yl)oxypropanamide |
|---|---|
| PubChem CID | 172666857 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N,N-dimethyl-2-(4-pyridin-4-ylnaphthalen-2-yl)oxypropanamide |
| SMILES | CC(Oc1cc(-c2ccncc2)c2ccccc2c1)C(=O)N(C)C |
| InChI | InChI=1S/C20H20N2O2/c1-14(20(23)22(2)3)24-17-12-16-6-4-5-7-18(16)19(13-17)15-8-10-21-11-9-15/h4-14H,1-3H3 |
| InChIKey | DZZCLGVRYJCZCG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |