C26H29N3O2 — CID 172666895
N-(3-amino-3-oxopropyl)-5-[4-(1-pyrrolidin-1-ylethyl)phenyl]naphthalene-2-carboxamide (PubChem CID 172666895) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-5-[4-(1-pyrrolidin-1-ylethyl)phenyl]naphthalene-2-carboxamide.
| Compound Name | N-(3-amino-3-oxopropyl)-5-[4-(1-pyrrolidin-1-ylethyl)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 172666895 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-5-[4-(1-pyrrolidin-1-ylethyl)phenyl]naphthalene-2-carboxamide |
| SMILES | CC(c1ccc(-c2cccc3cc(C(=O)NCCC(N)=O)ccc23)cc1)N1CCCC1 |
| InChI | InChI=1S/C26H29N3O2/c1-18(29-15-2-3-16-29)19-7-9-20(10-8-19)23-6-4-5-21-17-22(11-12-24(21)23)26(31)28-14-13-25(27)30/h4-12,17-18H,2-3,13-16H2,1H3,(H2,27,30)(H,28,31) |
| InChIKey | UUGPYQWERFPAQM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |