C22H30N4O3 — CID 172668754
N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N,4-dimethyl-2-oxo-1-(oxolan-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 172668754) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N,4-dimethyl-2-oxo-1-(oxolan-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N,4-dimethyl-2-oxo-1-(oxolan-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172668754 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N,4-dimethyl-2-oxo-1-(oxolan-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | Cc1ccn(CC2CCCO2)c(=O)c1C(=O)N(C)Cc1n[nH]c2c1CCCCC2 |
| InChI | InChI=1S/C22H30N4O3/c1-15-10-11-26(13-16-7-6-12-29-16)22(28)20(15)21(27)25(2)14-19-17-8-4-3-5-9-18(17)23-24-19/h10-11,16H,3-9,12-14H2,1-2H3,(H,23,24) |
| InChIKey | DBYOMKFGYHDGDH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |