C22H23FN2O2 — CID 172669326
N-[5-(2,5-dihydropyrrole-1-carbonyl)-2-methylphenyl]-4-(4-fluorophenyl)butanamide (PubChem CID 172669326) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[5-(2,5-dihydropyrrole-1-carbonyl)-2-methylphenyl]-4-(4-fluorophenyl)butanamide.
| Compound Name | N-[5-(2,5-dihydropyrrole-1-carbonyl)-2-methylphenyl]-4-(4-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 172669326 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[5-(2,5-dihydropyrrole-1-carbonyl)-2-methylphenyl]-4-(4-fluorophenyl)butanamide |
| SMILES | Cc1ccc(C(=O)N2CC=CC2)cc1NC(=O)CCCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN2O2/c1-16-7-10-18(22(27)25-13-2-3-14-25)15-20(16)24-21(26)6-4-5-17-8-11-19(23)12-9-17/h2-3,7-12,15H,4-6,13-14H2,1H3,(H,24,26) |
| InChIKey | OFZQFIUUHKEJKS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|