C25H31N5O — CID 172670629
(1R,9S)-11-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-(piperidin-1-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 172670629) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is (1R,9S)-11-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-(piperidin-1-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-(piperidin-1-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 172670629 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | (1R,9S)-11-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-(piperidin-1-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1c(CN2CCCCC2)ccc2n1C[C@H]1C[C@@H]2CN(Cc2cn3ccccc3n2)C1 |
| InChI | InChI=1S/C25H31N5O/c31-25-20(15-27-9-3-1-4-10-27)7-8-23-21-12-19(14-30(23)25)13-28(16-21)17-22-18-29-11-5-2-6-24(29)26-22/h2,5-8,11,18-19,21H,1,3-4,9-10,12-17H2/t19-,21+/m0/s1 |
| InChIKey | YWNMFXKFNFKPJQ-PZJWPPBQSA-N |
| XLogP | 3.10 |
| TPSA | 45.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |