C22H27F2N5O — CID 176505817
(1R,9S)-5-[(3,3-difluoropiperidin-1-yl)methyl]-11-(pyrazin-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 176505817) has the molecular formula C22H27F2N5O and a molecular weight of 415.49 g/mol. Its IUPAC name is (1R,9S)-5-[(3,3-difluoropiperidin-1-yl)methyl]-11-(pyrazin-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-5-[(3,3-difluoropiperidin-1-yl)methyl]-11-(pyrazin-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 176505817 |
| Molecular Formula | C22H27F2N5O |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | (1R,9S)-5-[(3,3-difluoropiperidin-1-yl)methyl]-11-(pyrazin-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1c(CN2CCCC(F)(F)C2)ccc2n1C[C@H]1C[C@@H]2CN(Cc2cnccn2)C1 |
| InChI | InChI=1S/C22H27F2N5O/c23-22(24)4-1-7-27(15-22)12-17-2-3-20-18-8-16(11-29(20)21(17)30)10-28(13-18)14-19-9-25-5-6-26-19/h2-3,5-6,9,16,18H,1,4,7-8,10-15H2/t16-,18+/m0/s1 |
| InChIKey | JNCPLKDXRFSBFA-FUHWJXTLSA-N |
| XLogP | 2.49 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |