C21H23N3O3 — CID 172671683
(1R,9S)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-5-carboxamide (PubChem CID 172671683) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (1R,9S)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-5-carboxamide.
| Compound Name | (1R,9S)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-5-carboxamide |
|---|---|
| PubChem CID | 172671683 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (1R,9S)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-5-carboxamide |
| SMILES | O=C(N[C@@H]1c2ccccc2C[C@@H]1O)c1ccc2n(c1=O)C[C@@H]1CNC[C@H]2C1 |
| InChI | InChI=1S/C21H23N3O3/c25-18-8-13-3-1-2-4-15(13)19(18)23-20(26)16-5-6-17-14-7-12(9-22-10-14)11-24(17)21(16)27/h1-6,12,14,18-19,22,25H,7-11H2,(H,23,26)/t12-,14+,18-,19+/m0/s1 |
| InChIKey | AXLUMJIQBPKEJD-JUUKFZBDSA-N |
| XLogP | 0.94 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |