C23H26N4O2 — CID 172673028
(1R,9S)-5-(1H-imidazol-2-yl)-11-(2-phenylmethoxyethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 172673028) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is (1R,9S)-5-(1H-imidazol-2-yl)-11-(2-phenylmethoxyethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-5-(1H-imidazol-2-yl)-11-(2-phenylmethoxyethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 172673028 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (1R,9S)-5-(1H-imidazol-2-yl)-11-(2-phenylmethoxyethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1c(-c2ncc[nH]2)ccc2n1C[C@H]1C[C@@H]2CN(CCOCc2ccccc2)C1 |
| InChI | InChI=1S/C23H26N4O2/c28-23-20(22-24-8-9-25-22)6-7-21-19-12-18(14-27(21)23)13-26(15-19)10-11-29-16-17-4-2-1-3-5-17/h1-9,18-19H,10-16H2,(H,24,25)/t18-,19+/m0/s1 |
| InChIKey | UFWVEEGBYAVIMG-RBUKOAKNSA-N |
| XLogP | 2.87 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|