C29H37NO — CID 172676378
(4S)-2-[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]-4-benzyl-4,5-dihydro-1,3-oxazole (PubChem CID 172676378) has the molecular formula C29H37NO and a molecular weight of 415.62 g/mol. Its IUPAC name is (4S)-2-[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]-4-benzyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]-4-benzyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 172676378 |
| Molecular Formula | C29H37NO |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | (4S)-2-[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]-4-benzyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(C3=N[C@@H](Cc4ccccc4)CO3)CCC[C@]21C |
| InChI | InChI=1S/C29H37NO/c1-20(2)22-11-13-25-23(18-22)12-14-26-28(25,3)15-8-16-29(26,4)27-30-24(19-31-27)17-21-9-6-5-7-10-21/h5-7,9-11,13,18,20,24,26H,8,12,14-17,19H2,1-4H3/t24-,26+,28+,29+/m0/s1 |
| InChIKey | PFWRTIXSKARFAV-KQVHQZGESA-N |
| XLogP | 6.86 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |