C30H38FN5O6S — CID 172676476
(3,5,6-trimethylpyrazin-2-yl)methyl (E,3S,5S)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate (PubChem CID 172676476) has the molecular formula C30H38FN5O6S and a molecular weight of 615.73 g/mol. Its IUPAC name is (3,5,6-trimethylpyrazin-2-yl)methyl (E,3S,5S)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate.
| Compound Name | (3,5,6-trimethylpyrazin-2-yl)methyl (E,3S,5S)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 172676476 |
| Molecular Formula | C30H38FN5O6S |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | (3,5,6-trimethylpyrazin-2-yl)methyl (E,3S,5S)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate |
| SMILES | Cc1nc(C)c(COC(=O)C[C@@H](O)C[C@H](O)/C=C/c2c(-c3ccc(F)cc3)nc(N(C)S(C)(=O)=O)nc2C(C)C)nc1C |
| InChI | InChI=1S/C30H38FN5O6S/c1-17(2)28-25(29(21-8-10-22(31)11-9-21)35-30(34-28)36(6)43(7,40)41)13-12-23(37)14-24(38)15-27(39)42-16-26-20(5)32-18(3)19(4)33-26/h8-13,17,23-24,37-38H,14-16H2,1-7H3/b13-12+/t23-,24+/m1/s1 |
| InChIKey | AOGOREPTYXROTF-ZBFVSKLGSA-N |
| XLogP | 3.78 |
| TPSA | 155.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |