C17H15FN4 — CID 172678638
5-(2,6-dimethyl-4-pyridinyl)-6-(4-fluorophenyl)pyrazin-2-amine (PubChem CID 172678638) has the molecular formula C17H15FN4 and a molecular weight of 294.33 g/mol. Its IUPAC name is 5-(2,6-dimethyl-4-pyridinyl)-6-(4-fluorophenyl)pyrazin-2-amine.
| Compound Name | 5-(2,6-dimethyl-4-pyridinyl)-6-(4-fluorophenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 172678638 |
| Molecular Formula | C17H15FN4 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 5-(2,6-dimethyl-4-pyridinyl)-6-(4-fluorophenyl)pyrazin-2-amine |
| SMILES | Cc1cc(-c2ncc(N)nc2-c2ccc(F)cc2)cc(C)n1 |
| InChI | InChI=1S/C17H15FN4/c1-10-7-13(8-11(2)21-10)16-17(22-15(19)9-20-16)12-3-5-14(18)6-4-12/h3-9H,1-2H3,(H2,19,22) |
| InChIKey | ABVUHCQJPGHKRN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |