C15H22IN3O — CID 172678771
N-(6-iodo-3-pyridinyl)-1-(2-methylbutan-2-yl)pyrrolidine-2-carboxamide (PubChem CID 172678771) has the molecular formula C15H22IN3O and a molecular weight of 387.27 g/mol. Its IUPAC name is N-(6-iodo-3-pyridinyl)-1-(2-methylbutan-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-(6-iodo-3-pyridinyl)-1-(2-methylbutan-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 172678771 |
| Molecular Formula | C15H22IN3O |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-(6-iodo-3-pyridinyl)-1-(2-methylbutan-2-yl)pyrrolidine-2-carboxamide |
| SMILES | CCC(C)(C)N1CCCC1C(=O)Nc1ccc(I)nc1 |
| InChI | InChI=1S/C15H22IN3O/c1-4-15(2,3)19-9-5-6-12(19)14(20)18-11-7-8-13(16)17-10-11/h7-8,10,12H,4-6,9H2,1-3H3,(H,18,20) |
| InChIKey | ACGDAHOAFOSRLD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|