C11H11F2NO4 — CID 172679884
1-[3-(1,1-difluoro-2-methoxyethyl)-5-nitrophenyl]ethanone (PubChem CID 172679884) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is 1-[3-(1,1-difluoro-2-methoxyethyl)-5-nitrophenyl]ethanone.
| Compound Name | 1-[3-(1,1-difluoro-2-methoxyethyl)-5-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 172679884 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 1-[3-(1,1-difluoro-2-methoxyethyl)-5-nitrophenyl]ethanone |
| SMILES | COCC(F)(F)c1cc(C(C)=O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11F2NO4/c1-7(15)8-3-9(11(12,13)6-18-2)5-10(4-8)14(16)17/h3-5H,6H2,1-2H3 |
| InChIKey | AGDFJLBENBOTGX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|