C37H48N6O6S — CID 172679961
1,2-oxazol-5-ylmethyl N-[3-hydroxy-1-[[(2S)-3-methyl-2-[[methyl-[(2-propyl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 172679961) has the molecular formula C37H48N6O6S and a molecular weight of 704.89 g/mol. Its IUPAC name is 1,2-oxazol-5-ylmethyl N-[3-hydroxy-1-[[(2S)-3-methyl-2-[[methyl-[(2-propyl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 1,2-oxazol-5-ylmethyl N-[3-hydroxy-1-[[(2S)-3-methyl-2-[[methyl-[(2-propyl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 172679961 |
| Molecular Formula | C37H48N6O6S |
| Molecular Weight | 704.89 g/mol |
| Exact Mass | 704.34 |
| IUPAC Name | 1,2-oxazol-5-ylmethyl N-[3-hydroxy-1-[[(2S)-3-methyl-2-[[methyl-[(2-propyl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CCCc1nc(CN(C)C(=O)N[C@H](C(=O)NC(c2ccccc2)C(NC(=O)OCc2ccno2)C(O)CCCc2ccccc2)C(C)C)cs1 |
| InChI | InChI=1S/C37H48N6O6S/c1-5-13-31-39-28(24-50-31)22-43(4)36(46)41-32(25(2)3)35(45)40-33(27-17-10-7-11-18-27)34(42-37(47)48-23-29-20-21-38-49-29)30(44)19-12-16-26-14-8-6-9-15-26/h6-11,14-15,17-18,20-21,24-25,30,32-34,44H,5,12-13,16,19,22-23H2,1-4H3,(H,40,45)(H,41,46)(H,42,47)/t30?,32-,33?,34?/m0/s1 |
| InChIKey | AGIYNXGKDLUOMU-RTPTWOPVSA-N |
| XLogP | 5.79 |
| TPSA | 158.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.89 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |