C36H46N6O7S — CID 22862995
1,2-oxazol-5-ylmethyl N-[(2S,3S,5S)-5-[[(2S)-2-[[(2-ethoxy-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 22862995) has the molecular formula C36H46N6O7S and a molecular weight of 706.87 g/mol. Its IUPAC name is 1,2-oxazol-5-ylmethyl N-[(2S,3S,5S)-5-[[(2S)-2-[[(2-ethoxy-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 1,2-oxazol-5-ylmethyl N-[(2S,3S,5S)-5-[[(2S)-2-[[(2-ethoxy-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 22862995 |
| Molecular Formula | C36H46N6O7S |
| Molecular Weight | 706.87 g/mol |
| Exact Mass | 706.31 |
| IUPAC Name | 1,2-oxazol-5-ylmethyl N-[(2S,3S,5S)-5-[[(2S)-2-[[(2-ethoxy-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CCOc1nc(CN(C)C(=O)N[C@H](C(=O)N[C@@H](Cc2ccccc2)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc2ccno2)C(C)C)cs1 |
| InChI | InChI=1S/C36H46N6O7S/c1-5-47-36-39-28(23-50-36)21-42(4)34(45)41-32(24(2)3)33(44)38-27(18-25-12-8-6-9-13-25)20-31(43)30(19-26-14-10-7-11-15-26)40-35(46)48-22-29-16-17-37-49-29/h6-17,23-24,27,30-32,43H,5,18-22H2,1-4H3,(H,38,44)(H,40,46)(H,41,45)/t27-,30-,31-,32-/m0/s1 |
| InChIKey | DOPGIKAEBNMTIO-QJANCWQKSA-N |
| XLogP | 4.71 |
| TPSA | 168.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.87 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |