C34H48N6O5S — CID 18655586
tert-butyl N-[(2S,3S,5S)-5-[[(2S)-2-[[(2-amino-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 18655586) has the molecular formula C34H48N6O5S and a molecular weight of 652.86 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,5S)-5-[[(2S)-2-[[(2-amino-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,5S)-5-[[(2S)-2-[[(2-amino-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 18655586 |
| Molecular Formula | C34H48N6O5S |
| Molecular Weight | 652.86 g/mol |
| Exact Mass | 652.34 |
| IUPAC Name | tert-butyl N-[(2S,3S,5S)-5-[[(2S)-2-[[(2-amino-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)N(C)Cc1csc(N)n1)C(=O)N[C@@H](Cc1ccccc1)C[C@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H48N6O5S/c1-22(2)29(39-32(43)40(6)20-26-21-46-31(35)37-26)30(42)36-25(17-23-13-9-7-10-14-23)19-28(41)27(18-24-15-11-8-12-16-24)38-33(44)45-34(3,4)5/h7-16,21-22,25,27-29,41H,17-20H2,1-6H3,(H2,35,37)(H,36,42)(H,38,44)(H,39,43)/t25-,27-,28-,29-/m0/s1 |
| InChIKey | NJPXDLXFJQLFPE-AMEOFWRWSA-N |
| XLogP | 4.51 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.86 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |