C16H37IN+ — CID 172681101
iodanium N-(2,2-dimethylpropyl)-2-methyldecan-1-amine (PubChem CID 172681101) has the molecular formula C16H37IN+ and a molecular weight of 370.38 g/mol. Its IUPAC name is iodanium N-(2,2-dimethylpropyl)-2-methyldecan-1-amine.
| Compound Name | iodanium N-(2,2-dimethylpropyl)-2-methyldecan-1-amine |
|---|---|
| PubChem CID | 172681101 |
| Molecular Formula | C16H37IN+ |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | iodanium N-(2,2-dimethylpropyl)-2-methyldecan-1-amine |
| SMILES | CCCCCCCCC(C)CNCC(C)(C)C.[IH2+] |
| InChI | InChI=1S/C16H35N.H2I/c1-6-7-8-9-10-11-12-15(2)13-17-14-16(3,4)5;/h15,17H,6-14H2,1-5H3;1H2/q;+1 |
| InChIKey | FCLPHLGMJYVUTK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|