About 1-phenyl-2H-1,3-thiazin-1-ium
1-phenyl-2H-1,3-thiazin-1-ium (PubChem CID 172681728) has the molecular formula C10H10NS+
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-phenyl-2H-1,3-thiazin-1-ium.
Molecular Properties
| Compound Name | 1-phenyl-2H-1,3-thiazin-1-ium |
| PubChem CID | 172681728 |
| Molecular Formula | C10H10NS+ |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 1-phenyl-2H-1,3-thiazin-1-ium |
| SMILES | C1=C[S+](c2ccccc2)CN=C1 |
| InChI | InChI=1S/C10H10NS/c1-2-5-10(6-3-1)12-8-4-7-11-9-12/h1-8H,9H2/q+1 |
| InChIKey | AMMPGSUARCDGDV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-2H-1,3-thiazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2H-1,3-thiazin-1-ium?
The IUPAC name of 1-phenyl-2H-1,3-thiazin-1-ium (CID 172681728) is 1-phenyl-2H-1,3-thiazin-1-ium.
What is the SMILES notation for 1-phenyl-2H-1,3-thiazin-1-ium?
The canonical SMILES for 1-phenyl-2H-1,3-thiazin-1-ium is C1=C[S+](c2ccccc2)CN=C1.
What is the InChIKey of 1-phenyl-2H-1,3-thiazin-1-ium?
The InChIKey is AMMPGSUARCDGDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10NS/c1-2-5-10(6-3-1)12-8-4-7-11-9-12/h1-8H,9H2/q+1.
What are the key properties of 1-phenyl-2H-1,3-thiazin-1-ium?
1-phenyl-2H-1,3-thiazin-1-ium has a molecular weight of 176.26 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2H-1,3-thiazin-1-ium is sourced from PubChem (CID 172681728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).