C32H32NO7PS — CID 172683061
[2-ethoxy-3-(4-phenylmethoxynaphthalen-1-yl)oxypropyl] [3-(1,3-thiazol-3-ium-3-ylmethyl)phenyl] phosphate (PubChem CID 172683061) has the molecular formula C32H32NO7PS and a molecular weight of 605.65 g/mol. Its IUPAC name is [2-ethoxy-3-(4-phenylmethoxynaphthalen-1-yl)oxypropyl] [3-(1,3-thiazol-3-ium-3-ylmethyl)phenyl] phosphate.
| Compound Name | [2-ethoxy-3-(4-phenylmethoxynaphthalen-1-yl)oxypropyl] [3-(1,3-thiazol-3-ium-3-ylmethyl)phenyl] phosphate |
|---|---|
| PubChem CID | 172683061 |
| Molecular Formula | C32H32NO7PS |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | [2-ethoxy-3-(4-phenylmethoxynaphthalen-1-yl)oxypropyl] [3-(1,3-thiazol-3-ium-3-ylmethyl)phenyl] phosphate |
| SMILES | CCOC(COc1ccc(OCc2ccccc2)c2ccccc12)COP(=O)([O-])Oc1cccc(C[n+]2ccsc2)c1 |
| InChI | InChI=1S/C32H32NO7PS/c1-2-36-28(23-39-41(34,35)40-27-12-8-11-26(19-27)20-33-17-18-42-24-33)22-38-32-16-15-31(29-13-6-7-14-30(29)32)37-21-25-9-4-3-5-10-25/h3-19,24,28H,2,20-23H2,1H3 |
| InChIKey | AQYOOBGFNAMHHF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 90.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|