C21H22N2O5S — CID 17268445
ethyl 2-[[(E)-2-cyano-3-(2,4-diethoxyphenyl)prop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 17268445) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is ethyl 2-[[(E)-2-cyano-3-(2,4-diethoxyphenyl)prop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-2-cyano-3-(2,4-diethoxyphenyl)prop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17268445 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | ethyl 2-[[(E)-2-cyano-3-(2,4-diethoxyphenyl)prop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccsc1NC(=O)/C(C#N)=C/c1ccc(OCC)cc1OCC |
| InChI | InChI=1S/C21H22N2O5S/c1-4-26-16-8-7-14(18(12-16)27-5-2)11-15(13-22)19(24)23-20-17(9-10-29-20)21(25)28-6-3/h7-12H,4-6H2,1-3H3,(H,23,24)/b15-11+ |
| InChIKey | WPUGDRSFUKIXCA-RVDMUPIBSA-N |
| XLogP | 4.27 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|