C17H10F6N2O — CID 172685867
1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazole-6-carbaldehyde (PubChem CID 172685867) has the molecular formula C17H10F6N2O and a molecular weight of 372.27 g/mol. Its IUPAC name is 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazole-6-carbaldehyde.
| Compound Name | 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazole-6-carbaldehyde |
|---|---|
| PubChem CID | 172685867 |
| Molecular Formula | C17H10F6N2O |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazole-6-carbaldehyde |
| SMILES | O=Cc1ccc2cnn(Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2c1 |
| InChI | InChI=1S/C17H10F6N2O/c18-16(19,20)13-4-3-12(14(6-13)17(21,22)23)8-25-15-5-10(9-26)1-2-11(15)7-24-25/h1-7,9H,8H2 |
| InChIKey | BAJMORKTFGOGKV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|