C22H19ClO3 — CID 172688033
2-[(4-chlorophenyl)methoxy]-5-(4-hydroxy-3,5-dimethylphenyl)benzaldehyde (PubChem CID 172688033) has the molecular formula C22H19ClO3 and a molecular weight of 366.84 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methoxy]-5-(4-hydroxy-3,5-dimethylphenyl)benzaldehyde.
| Compound Name | 2-[(4-chlorophenyl)methoxy]-5-(4-hydroxy-3,5-dimethylphenyl)benzaldehyde |
|---|---|
| PubChem CID | 172688033 |
| Molecular Formula | C22H19ClO3 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[(4-chlorophenyl)methoxy]-5-(4-hydroxy-3,5-dimethylphenyl)benzaldehyde |
| SMILES | Cc1cc(-c2ccc(OCc3ccc(Cl)cc3)c(C=O)c2)cc(C)c1O |
| InChI | InChI=1S/C22H19ClO3/c1-14-9-18(10-15(2)22(14)25)17-5-8-21(19(11-17)12-24)26-13-16-3-6-20(23)7-4-16/h3-12,25H,13H2,1-2H3 |
| InChIKey | BHKJBIZNKANYMO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|