C17H20ClNO2 — CID 142322438
5-chloro-2-[(2,6-dimethyl-4-pyridinyl)methoxy]benzaldehyde;ethane (PubChem CID 142322438) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 5-chloro-2-[(2,6-dimethyl-4-pyridinyl)methoxy]benzaldehyde;ethane.
| Compound Name | 5-chloro-2-[(2,6-dimethyl-4-pyridinyl)methoxy]benzaldehyde;ethane |
|---|---|
| PubChem CID | 142322438 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-chloro-2-[(2,6-dimethyl-4-pyridinyl)methoxy]benzaldehyde;ethane |
| SMILES | CC.Cc1cc(COc2ccc(Cl)cc2C=O)cc(C)n1 |
| InChI | InChI=1S/C15H14ClNO2.C2H6/c1-10-5-12(6-11(2)17-10)9-19-15-4-3-14(16)7-13(15)8-18;1-2/h3-8H,9H2,1-2H3;1-2H3 |
| InChIKey | JEOXDJSRHJOBPE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|