C11H11N3O3 — CID 172688062
5-anilino-6-(hydroxymethyl)-1H-pyrimidine-2,4-dione (PubChem CID 172688062) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 5-anilino-6-(hydroxymethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-anilino-6-(hydroxymethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 172688062 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 5-anilino-6-(hydroxymethyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(CO)c(Nc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H11N3O3/c15-6-8-9(10(16)14-11(17)13-8)12-7-4-2-1-3-5-7/h1-5,12,15H,6H2,(H2,13,14,16,17) |
| InChIKey | BHNNEKKXDTWNNQ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |