C33H35FN6O3 — CID 172689934
4-(2,5-diazabicyclo[2.2.2]octan-2-yl)-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6-dihydropyrido[3,4-d]pyrimidin-8-one (PubChem CID 172689934) has the molecular formula C33H35FN6O3 and a molecular weight of 582.68 g/mol. Its IUPAC name is 4-(2,5-diazabicyclo[2.2.2]octan-2-yl)-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6-dihydropyrido[3,4-d]pyrimidin-8-one.
| Compound Name | 4-(2,5-diazabicyclo[2.2.2]octan-2-yl)-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6-dihydropyrido[3,4-d]pyrimidin-8-one |
|---|---|
| PubChem CID | 172689934 |
| Molecular Formula | C33H35FN6O3 |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 4-(2,5-diazabicyclo[2.2.2]octan-2-yl)-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6-dihydropyrido[3,4-d]pyrimidin-8-one |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(N3CCc4c(nc(OCC56CCCN5CCC6)nc4N4CC5CCC4CN5)C3=O)c12 |
| InChI | InChI=1S/C33H35FN6O3/c1-2-24-26(34)8-5-20-15-23(41)16-27(28(20)24)39-14-9-25-29(31(39)42)36-32(43-19-33-10-3-12-38(33)13-4-11-33)37-30(25)40-18-21-6-7-22(40)17-35-21/h1,5,8,15-16,21-22,35,41H,3-4,6-7,9-14,17-19H2 |
| InChIKey | BNUOCNBNHXHFES-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|