C15H22NO2S+ — CID 172690784
methyl-[4-(2-methyl-2-morpholin-4-ylpropanoyl)cyclohexa-2,4-dien-1-ylidene]sulfanium (PubChem CID 172690784) has the molecular formula C15H22NO2S+ and a molecular weight of 280.41 g/mol. Its IUPAC name is methyl-[4-(2-methyl-2-morpholin-4-ylpropanoyl)cyclohexa-2,4-dien-1-ylidene]sulfanium.
| Compound Name | methyl-[4-(2-methyl-2-morpholin-4-ylpropanoyl)cyclohexa-2,4-dien-1-ylidene]sulfanium |
|---|---|
| PubChem CID | 172690784 |
| Molecular Formula | C15H22NO2S+ |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | methyl-[4-(2-methyl-2-morpholin-4-ylpropanoyl)cyclohexa-2,4-dien-1-ylidene]sulfanium |
| SMILES | C/[S+]=C1/C=CC(C(=O)C(C)(C)N2CCOCC2)=CC1 |
| InChI | InChI=1S/C15H22NO2S/c1-15(2,16-8-10-18-11-9-16)14(17)12-4-6-13(19-3)7-5-12/h4-6H,7-11H2,1-3H3/q+1 |
| InChIKey | BQMOVSZLWZTNJD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|