C18H29NO2 — CID 144803146
ethane;(4E,5Z)-2-methyl-2-morpholin-4-yl-4-prop-2-enylideneocta-5,7-dien-3-one (PubChem CID 144803146) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is ethane;(4E,5Z)-2-methyl-2-morpholin-4-yl-4-prop-2-enylideneocta-5,7-dien-3-one.
| Compound Name | ethane;(4E,5Z)-2-methyl-2-morpholin-4-yl-4-prop-2-enylideneocta-5,7-dien-3-one |
|---|---|
| PubChem CID | 144803146 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | ethane;(4E,5Z)-2-methyl-2-morpholin-4-yl-4-prop-2-enylideneocta-5,7-dien-3-one |
| SMILES | C=C/C=C\C(=C/C=C)C(=O)C(C)(C)N1CCOCC1.CC |
| InChI | InChI=1S/C16H23NO2.C2H6/c1-5-7-9-14(8-6-2)15(18)16(3,4)17-10-12-19-13-11-17;1-2/h5-9H,1-2,10-13H2,3-4H3;1-2H3/b9-7-,14-8+; |
| InChIKey | VIYANZYONJWDOA-XZUBSDCWSA-N |
| XLogP | 3.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|