C11H15NO2 — CID 175431729
6-methyl-6-morpholin-4-ylcyclohexa-2,4-dien-1-one (PubChem CID 175431729) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 6-methyl-6-morpholin-4-ylcyclohexa-2,4-dien-1-one.
| Compound Name | 6-methyl-6-morpholin-4-ylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 175431729 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 6-methyl-6-morpholin-4-ylcyclohexa-2,4-dien-1-one |
| SMILES | CC1(N2CCOCC2)C=CC=CC1=O |
| InChI | InChI=1S/C11H15NO2/c1-11(5-3-2-4-10(11)13)12-6-8-14-9-7-12/h2-5H,6-9H2,1H3 |
| InChIKey | KUDQWRFAAZYTME-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |