C10H11NO3 — CID 160852428
3-morpholin-4-ylcyclohexa-3,5-diene-1,2-dione (PubChem CID 160852428) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 3-morpholin-4-ylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3-morpholin-4-ylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 160852428 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3-morpholin-4-ylcyclohexa-3,5-diene-1,2-dione |
| SMILES | O=C1C=CC=C(N2CCOCC2)C1=O |
| InChI | InChI=1S/C10H11NO3/c12-9-3-1-2-8(10(9)13)11-4-6-14-7-5-11/h1-3H,4-7H2 |
| InChIKey | SJKUYFOADNHLGN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|