C10H13NO2 — CID 141267365
4-morpholin-4-ylcyclohexa-2,4-dien-1-one (PubChem CID 141267365) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-morpholin-4-ylcyclohexa-2,4-dien-1-one.
| Compound Name | 4-morpholin-4-ylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 141267365 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-morpholin-4-ylcyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC(N2CCOCC2)=CC1 |
| InChI | InChI=1S/C10H13NO2/c12-10-3-1-9(2-4-10)11-5-7-13-8-6-11/h1-3H,4-8H2 |
| InChIKey | SRNTVHKOOGJAEI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |