C42H57Bi3S6 — CID 172691226
[3,5-bis[bis(cyclohex-2-en-1-ylsulfanyl)bismuthanyl]phenyl]-bis(cyclohex-2-en-1-ylsulfanyl)bismuthane (PubChem CID 172691226) has the molecular formula C42H57Bi3S6 and a molecular weight of 1381.26 g/mol. Its IUPAC name is [3,5-bis[bis(cyclohex-2-en-1-ylsulfanyl)bismuthanyl]phenyl]-bis(cyclohex-2-en-1-ylsulfanyl)bismuthane.
| Compound Name | [3,5-bis[bis(cyclohex-2-en-1-ylsulfanyl)bismuthanyl]phenyl]-bis(cyclohex-2-en-1-ylsulfanyl)bismuthane |
|---|---|
| PubChem CID | 172691226 |
| Molecular Formula | C42H57Bi3S6 |
| Molecular Weight | 1381.26 g/mol |
| Exact Mass | 1380.22 |
| IUPAC Name | [3,5-bis[bis(cyclohex-2-en-1-ylsulfanyl)bismuthanyl]phenyl]-bis(cyclohex-2-en-1-ylsulfanyl)bismuthane |
| SMILES | C1=CC(S[Bi](SC2C=CCCC2)c2cc([Bi](SC3C=CCCC3)SC3C=CCCC3)cc([Bi](SC3C=CCCC3)SC3C=CCCC3)c2)CCC1 |
| InChI | InChI=1S/6C6H10S.C6H3.3Bi/c6*7-6-4-2-1-3-5-6;1-2-4-6-5-3-1;;;/h6*2,4,6-7H,1,3,5H2;1,4-5H;;;/q;;;;;;;3*+2/p-6 |
| InChIKey | BRYRWVFMAARQAZ-UHFFFAOYSA-H |
| XLogP | 11.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1381.26 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|