C48H69Bi3O6 — CID 172704484
[3,5-bis[di(cyclohept-2-en-1-yloxy)bismuthanyl]phenyl]-di(cyclohept-2-en-1-yloxy)bismuthane (PubChem CID 172704484) has the molecular formula C48H69Bi3O6 and a molecular weight of 1369.01 g/mol. Its IUPAC name is [3,5-bis[di(cyclohept-2-en-1-yloxy)bismuthanyl]phenyl]-di(cyclohept-2-en-1-yloxy)bismuthane.
| Compound Name | [3,5-bis[di(cyclohept-2-en-1-yloxy)bismuthanyl]phenyl]-di(cyclohept-2-en-1-yloxy)bismuthane |
|---|---|
| PubChem CID | 172704484 |
| Molecular Formula | C48H69Bi3O6 |
| Molecular Weight | 1369.01 g/mol |
| Exact Mass | 1368.45 |
| IUPAC Name | [3,5-bis[di(cyclohept-2-en-1-yloxy)bismuthanyl]phenyl]-di(cyclohept-2-en-1-yloxy)bismuthane |
| SMILES | C1=CC(O[Bi](OC2C=CCCCC2)c2cc([Bi](OC3C=CCCCC3)OC3C=CCCCC3)cc([Bi](OC3C=CCCCC3)OC3C=CCCCC3)c2)CCCC1 |
| InChI | InChI=1S/6C7H11O.C6H3.3Bi/c6*8-7-5-3-1-2-4-6-7;1-2-4-6-5-3-1;;;/h6*3,5,7H,1-2,4,6H2;1,4-5H;;;/q6*-1;;3*+2 |
| InChIKey | DKBCVZGYAFUSDG-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1369.01 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|